AZD5438 10mM * 1mL in DMSO
AZD5438 is a potent inhibitor of cyclin-dependent kinase (CDK) 1, 2 and 9 (IC50 values are 16, 6 and 20 nM respectively).
| Trivial name | AZD5438 10mM * 1mL in DMSO |
| Catalog Number | A11105-10mM-D |
| Alternative Name(s) | 4-[2-Methyl-1-(1-methylethyl)-1H-imidazol-5-yl]-N-[4-(methylsulfonyl)phenyl]-2-pyrimidinamine |
| Molecular Formula | C18H21N5O2S |
| CAS# | 602306-29-6 |
| SMILES | CC1=NC=C(N1C(C)C)C2=NC(=NC=C2)NC3=CC=C(C=C3)S(=O)(=O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/azd5438.html |
