AZD5438 10mM * 1mL in DMSO
AZD5438 is a potent inhibitor of cyclin-dependent kinase (CDK) 1, 2 and 9 (IC50 values are 16, 6 and 20 nM respectively).
Trivial name | AZD5438 10mM * 1mL in DMSO |
Catalog Number | A11105-10mM-D |
Alternative Name(s) | 4-[2-Methyl-1-(1-methylethyl)-1H-imidazol-5-yl]-N-[4-(methylsulfonyl)phenyl]-2-pyrimidinamine |
Molecular Formula | C₁₈H₂₁N₅O₂S |
CAS# | 602306-29-6 |
SMILES | CC1=NC=C(N1C(C)C)C2=NC(=NC=C2)NC3=CC=C(C=C3)S(=O)(=O)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/azd5438.html |