Creatine Monohydrate
Creatine monohydrate is a pharmaceutical raw material and health product additive. It can inhibit the production of muscle fatigue factors, reduce fatigue and tension, restore physical fitness, accelerate human protein synthesis, make muscles stronger, enhance muscle elasticity, reduce cholesterol, blood lipid and blood sugar levels, improve muscle atrophy in middle-aged and elderly people, and delay aging.
Catalog Number | ABA-103 |
Alternative Name(s) | Amidinosarcosine Monohydrate; [(diaminomethylidene)(methyl)ammonio]acetate |
CAS# | 6020-87-7 |
SMILES | O=C(O)CN(C(N)=N)C.[H]O[H] |
Size | Inquiry |
Supplier Page | https://www.agingclocks.com/creatine-monohydrate-item-1972.html |