OAC2
OAC2 is an Oct4 activator which activates expression through the Oct4 gene promoter; enhances reprogramming efficiency by increasing the rate of production of induced pluripotent stem cells (iPSCs) from embryonic fibroblasts; an analog of OAC1.
| Catalog Number | T2019 |
| Research Area | Membrane transporter/Ion channel |
| Molecular Formula | C15H12N2O |
| CAS# | 6019-39-2 |
| Purity | 99.76% |
| SMILES | O=C(Nc1cc2c([nH]cc2)cc1)c1ccccc1 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/OAC2 |
| Additional Information | https://www.targetmol.com/datasheet/T2019 |
