TWS119
GSK-3β inhibitor PI3K/Akt/mTOR Signaling|GSK-3
| Catalog Number | B1540-20 |
| Research Area | PI3K/Akt/mTOR Signaling|GSK-3 |
| Molecular Formula | C18H14N4O2 |
| CAS# | 601514-19-6 |
| Purity | 98% |
| SMILES | C1=CC(=CC(=C1)N)C2=CC3=C(N2)N=CN=C3OC4=CC=CC(=C4)O |
| Size | 20mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1540 |
