TWS119 10mM * 1mL in DMSO
TWS119 is a 4,6 disubstituted pyrrolopyrimidine that potently inhibits GSK3?? with an IC50 value of 30 nM.1 At 400 nM.
| Trivial name | TWS119 10mM * 1mL in DMSO |
| Catalog Number | A11223-10mM-D |
| Alternative Name(s) | 3-[[6-(3-aminophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]-phenol |
| Molecular Formula | C18H14N4O2 |
| CAS# | 601514-19-6 |
| SMILES | C1=CC(=CC(=C1)N)C2=CC3=C(N2)N=CN=C3OC4=CC=CC(=C4)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tws119.html |
