2-Oxobutanoic acid
2-Oxobutanoic acid (2-Oxobutyrate, 2-ketobutyric acid, 2-oxobutyric acid, alpha-ketobutyric acid, α-ketobutyric acid) is a substance that is involved in the metabolism of many amino acids as well as propanoate metabolism and C-5 branched dibasic acid metabolism.
| Trivial name | 2-Oxobutyrate, 2-ketobutyric acid, 2-oxobutyric acid, alpha-ketobutyric acid, α-ketobutyric acid |
| Catalog Number | S6329 |
| Molecular Formula | C4H6O3 |
| CAS# | 600-18-0 |
| Inchi | InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6,7) |
| Inchi Key | TYEYBOSBBBHJIV-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(=O)O |
| Size | 25ul |
| Supplier Page | http://www.selleckchem.com/products/oxobutanoic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/oxobutanoic-acid-chemical-structure-s6329.gif |