Quinine dihydrochloride
Quinine Dihydrochloride is a primary alkaloid of various species of Cinchona (Rubiaceae). It is also an antimalarial and muscle relaxant (skeletal).
| Catalog Number | T4333 |
| Alternative Name(s) | Quinine bimuriate |
| Research Area | Others |
| Molecular Formula | C20H26Cl2N2O2 |
| CAS# | 60-93-5 |
| Purity | 99.45% |
| SMILES | Cl.Cl.COc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CC[N@]3C[C@@H]4C=C)c2c1 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Quinine dihydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T4333 |