Phloretin
Phloretin, a dihydrochalcone flavonoid, can inhibit the active transport of glucose into cells by SGLT1 and SGLT2. It is mainly found in fruit and roots of apple tree.
| Trivial name | Dihydronaringenin; NSC-407292; RJC-02792 |
| Catalog Number | CSN11697 |
| Alternative Name(s) | Dihydronaringenin; NSC-407292; RJC-02792 |
| Research Area | Metabolic Disease |
| Molecular Formula | C15H14O5 |
| CAS# | 60-82-2 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(O)C=C(O)C=C1O)CCC2=CC=C(O)C=C2 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/phloretin.html |
