Phlorizin (Phloridzin) 10mM * 1mL in DMSO
Phlorizin is a competitive inhibitor of SGLT1 and SGLT2; this reduces renal glucose transport, lowering the amount of glucose in the blood.
Trivial name | Phlorizin (Phloridzin) 10mM * 1mL in DMSO |
Catalog Number | A10724-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C21H24O10 |
CAS# | 60-81-1 |
SMILES | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/phlorizin-phloridzin.html |