L-Tyrosine
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-30962 |
| Alternative Name(s) | Tyrosine;(-)-α-Amino-p-hydroxyhydrocinnamic Acid; Therigon; p-Tyrosine; (2S)-2-Amino-3-(4-hydroxyphenyl)propanoic Acid; (S)-2-Amino-3-(4-hydroxyphenyl)propanoic Acid; (S)-Tyrosine; (S)-α-Amino-4-hydroxybenzenepropanoic Acid; L-(-)-Tyrosine |
| Research Area | L-Tyrosine is one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters |
| Molecular Formula | C9H11NO3 |
| CAS# | 60-18-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H](C(O)=O)CC1=CC=C(O)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30962.html |
| Additional Information | NULL |