Gallic Acid Monohydrate
Gallic acid may be used as a standard in the photometric determination of total phenolics content by Folin-Ciocalteu method with potential role in epigenetic therapy of human cancers.
| Trivial name | Gallicum Acidum |
| Catalog Number | CSN16681 |
| Alternative Name(s) | Gallicum Acidum |
| Research Area | Cancer |
| Molecular Formula | C7H8O6 |
| CAS# | 5995-86-8 |
| Purity | ≥99% |
| SMILES | O=C(O)C1=CC(O)=C(O)C(O)=C1.[H]O[H] |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/gallic-acid-monohydrate.html |
