Gallic Acid Monohydrate
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-25094 |
| Alternative Name(s) | 3,4,5-Trihydroxybenzoic Acid Hydrate; 3,4,5-Trihydroxybenzoic Acid Monohydrate |
| Research Area | Gallic Acid is a phenolic acid with antioxidant activity. Gallic acid was found to protect human cells against oxidative damage and showed cytotoxicity against cancer cells. Gallic Acid and its esters also show antiviral and antifungal activities. |
| Molecular Formula | C7H8O6 |
| CAS# | 5995-86-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC(O)=C(O)C(O)=C1)=O.O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST25094.html |
| Additional Information | NULL |