N-(Phosphonomethyl)iminodiacetic acid hydrate
N-(Phosphonomethyl)iminodiacetic acid hydrate is the hydrated form of N-(phosphonomethyl)iminodiacetic acid (PMIDA; H4pmida). The solubility of PMIDA in various solvents and solvent mixtures has been studied. It is the starting material for the synthesis of N-(phosphonomethyl)iminodiacetate (pmida4-), a multidentate organic ligand. PMIDA undergoes molecular oxygen oxidation in the presence of metal salts to form N-(phosphonomethyl)glycine, also known as glyphosate. H4pmida forms the structural unit of various three-dimensional inorganic-organic hybrid compounds.
| Catalog Number | CBB1115972 |
| Molecular Formula | (HO)2P(O)CH2N(CH2CO2H)2 ยท H2O |
| CAS# | 5994-61-6 |
| Purity | >95% |
| Inchi | 1S/C5H10NO7P.H2O/c7-4(8)1-6(2-5(9)10)3-14(11,12)13;/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13);1H2 |
| Inchi Key | QTDRAPLUBFHWCT-UHFFFAOYSA-N |
| SMILES | [H]O[H].OC(=O)CN(CC(O)=O)CP(O)(O)=O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/n-phosphonomethyliminodiacetic-acid-hydrate-item-115972.html |