13,14-Dihydro-15-keto prostaglandin D2 | MedChemExpress (MCE)
13, 14-Dihydro-15-keto prostaglandin D2 (DK-PGD2) is a PGD2 metabolite formed by the 15-hydroxyl PGDH pathway. 13, 14-Dihydro-15-keto prostaglandin D2 is a selective agonist for the DP2 receptor. 13, 14-Dihydro-15-keto prostaglandin D2 can inhibit ion flux in canine colonic mucosa preparation[1].
| Trivial name | 13,14-Dihydro-15-keto prostaglandin D2 |
| Catalog Number | HY-118830 |
| Alternative Name(s) | DK-PGD2; 15-Oxo-13,14-dihydro-PGD2; 13,14-Dihydro-15-keto-PGD2 |
| Research Area | Endocrinology |
| CAS# | 59894-07-4 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@@H]1[C@H](C(C[C@@H]1O)=O)CCC(CCCCC)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/13-14-dihydro-15-keto-prostaglandin-d2.html |