15(R)-Prostaglandin D2 | MedChemExpress (MCE)
15(R)-Prostaglandin D2 is a potential prostatic hormone DP(2) receptor (Prostaglandin Receptor) agonist with anti-inflammatory activity. 15(R)-Prostaglandin D2 increases actin polymerization in human eosinophils and increases cAMP levels in platelets[1].
| Trivial name | 15(R)-Prostaglandin D2 |
| Catalog Number | HY-137308 |
| Alternative Name(s) | 15R-PGD2 |
| Research Area | Inflammation/Immunology |
| CAS# | 59894-05-2 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@@H]1[C@H](C(C[C@@H]1O)=O)/C=C/[C@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/15-r-prostaglandin-d2.html |