α-Lactose hydrate | MedChemExpress (MCE)
α-Lactose (hydrate) (α-D-Lactose (hydrate)) is the principal carbohydrate in the milk of most mammals. α-Lactose (hydrate) consists of glucose and galactose and exists in the form of two anomers, α and β. α-Lactose (hydrate) has many uses in the food and pharmaceutical industries, such as a free-flowing or agglomerating agent, a diluent for pigments, flavors, or enzymes[1][2][3].
| Trivial name | α-Lactose hydrate |
| Catalog Number | HY-W087904 |
| Alternative Name(s) | α-D-Lactose hydrate |
| Research Area | Others |
| CAS# | 5989-81-1 |
| Purity | ≥98.00% |
| SMILES | OC[C@@H](O[C@@H]([C@@H]([C@H]1O)O)O)[C@H]1O[C@@H]2O[C@@H]([C@@H]([C@@H]([C@H]2O)O)O)CO.O |
| PubChem Chemical Structure ID | 104938 |
| Size | 500 g |
| Supplier Page | https://www.medchemexpress.com/α-lactose-hydrate.html |