Cyclosporin A
Cyclosporin A, a non-polar cyclic oligopeptide, is an immunosuppressive agent that binds to cyclophilin and then inhibits calcineurin with IC50 of 7 nM in a cell-free assay. Cyclosporin A is generally given following transplant surgery to prevent rejection and has been used to test its toxic effect on a perfused 3D proximal tubule model.Cyclosporin A (NSC 290193) can be used to induce animal models of Chronic Rejection of Liver Transplantation.
| Trivial name | Cyclosporine A, Cyclosporine, Ciclosporin, CsA,NSC 290193 |
| Catalog Number | S2286 |
| Molecular Formula | C29H31NO7 |
| CAS# | 59865-13-3 |
| SMILES | CN(C)C(=O)C1C(C2(C(C1O)(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC=C(C=C4)OC)C5=CC=CC=C5 |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/Cyclosporin-A(Cyclosporine-A).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Cyclosporin-A-Cyclosporine-A-chemical-structure-S2286.gif |
