Apoatropine Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-T-48303 |
| Alternative Name(s) | Atropate-1αH,5αH-tropan-3α-ol Hydrochloride; Apoatropin Hydrochloride; endo-α-Methylenebenzeneacetic Acid 8-Methyl-8-azabicyclo[3.2.1]oct-3-yl Ester Hydrochloride; Apoatropin Hydrochloride; Apohyoscyamin Hydrochloride; Apohyoscyamine Hydrochloride; Atropamin Hydrochloride; Atropamine Hydrochloride; Atropyltropeine Hydrochloride; 500-55-0 |
| Research Area | Apoatropine is an alkaloid derivative with the potential to be an antibacterial. |
| Molecular Formula | C17H22ClNO2 |
| CAS# | 5978-81-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C1=CC=CC=C1)=C)O[C@H]2C[C@@H](CC3)N(C)[C@@H]3C2.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST48303.html |
| Additional Information | NULL |