Fexinidazole
Fexinidazole is a 5-nitroimidazole drug for the treatment of human sleeping sickness (human African trypanosomiasis [HAT]), caused by infection with species of the protozoan parasite Trypanosoma brucei.
| Trivial name | HOE 239 |
| Catalog Number | CSN11009 |
| Alternative Name(s) | HOE 239 |
| Research Area | Infection |
| Molecular Formula | C12H13N3O3S |
| CAS# | 59729-37-2 |
| Purity | ≥99% |
| SMILES | O=[N+](C1=CN=C(COC2=CC=C(SC)C=C2)N1C)[O-] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/fexinidazole.html |