Camostat Mesilate
Camostat mesylate is a trypsin-like protease inhibitor, inhibits airway epithelial sodium channel (ENaC) function with IC50 of 50 nM, less potent to trypsin, prostasin and matriptase. Also it inhibits transmembrane serine protease TMPRSS2, suggesting that it could block entry of SARS-Cov-2 (COVID-19) into lung cells in vitro.
| Trivial name | FOY-305; FOY-S-980 |
| Catalog Number | CSN11492 |
| Alternative Name(s) | FOY-305; FOY-S-980 |
| Research Area | Metabolic Disease|Infection|Cancer |
| Molecular Formula | C21H26N4O8S |
| CAS# | 59721-29-8 |
| Purity | ≥99% |
| SMILES | O=C(OCC(N(C)C)=O)CC1=CC=C(OC(C2=CC=C(NC(N)=N)C=C2)=O)C=C1.CS(=O)(O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/camostat-mesilate.html |