Camostat mesylate 25mg
Camostat mesylate is an orally active protease inhibitor. Known to inhibit trypsin and various inflammatory proteases including plasmin, kallikrein and thrombin.
| Trivial name | Camostat mesylate 25mg |
| Catalog Number | A11764-25 |
| Alternative Name(s) | 4-[[4-[(Aminoiminomethyl)amino]benz?oyl]oxy]benzeneacetic acid 2-(dimethylamino)-2-oxoethyl ester methanesulfonate |
| Molecular Formula | C20H22N4O5.CH3SO3H |
| CAS# | 59721-29-8 |
| SMILES | CN(C)C(=O)COC(=O)CC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)N=C(N)N.CS(=O)(=O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/camostat-mesylate.html |
