Megestrol acetate (Standard) | MedChemExpress (MCE)
Megestrol acetate (Standard) is the analytical standard of Megestrol acetate. This product is intended for research and analytical applications. Megestrol acetate is a synthetic and orally active progesteronal agent. Megestrol acetate is effective as an appetite stimulant for wasting syndromes such as cachexia. Megestrol acetate decreases nuclear and cytosol androgen receptors human BPH tissue. Megestrol acetate has the potential for HIV study and downregulates autophagic catabolic pathway[1][2][3][4][5].
| Trivial name | Megestrol acetate (Standard) |
| Catalog Number | HY-13676R |
| Research Area | Endocrinology; Cancer |
| CAS# | 595-33-5 |
| Purity | ≥98.00% |
| SMILES | CC([C@@]1(OC(C)=O)CC[C@@]2([H])[C@]3([H])C=C(C)C4=CC(CC[C@]4(C)[C@@]3([H])CC[C@]12C)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/megestrol-acetate-standard.html |