Testosterone Undecanoate
API Standard
| Catalog Number | CS-O-02525 |
| Research Area | Testosterone Undecanoate is the undecanoate ester form of the androgen testosterone, with gonadotropin-secretory inhibiting and hormone replacement activity. As testosterone inhibits the secretion of gonadotropins from the pituitary gland, administration |
| Molecular Formula | C30H48O3 |
| CAS# | 5949-44-0 |
| Purity | >98% |
| SMILES | C[C@@](C(CC1)=CC2=O)(CC2)[C@]3([H])[C@]1([H])[C@@](CC[C@@H]4OC(CCCCCCCCCC)=O)([H])[C@]4(C)CC3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02525.html |