Citric acid monohydrate
API Standard
| Catalog Number | CS-O-05633 |
| Alternative Name(s) | 2-hydroxypropane-1,2,3-hydrate |
| Research Area | Citric acid is used as an excipient in pharmaceutical preparations due to its antioxidant properties. It maintains stability of active ingredients and is used as a preservative. It is also used as an acidulant to control pH and acts as an anticoagulant by |
| Molecular Formula | C6H10O8 |
| CAS# | 5949-29-1 |
| Purity | >98% |
| SMILES | OC(CC(O)=O)(C(O)=O)CC(O)=O.O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05633.html |