Granotapide | MedChemExpress (MCE)
Granotapide (JTT-130) is an orally active microsomal triglyceride transfer protein (MTP) inhibitor. Granotapide reduces absorption of cholesterol and triglycerides through inhibition of MTP. Granotapide can be used for the research of dyslipidemia[1].
| Trivial name | Granotapide |
| Catalog Number | HY-119220 |
| Alternative Name(s) | JTT-130 |
| Research Area | Metabolic Disease |
| CAS# | 594842-13-4 |
| Purity | ≥98.0% |
| SMILES | CCOC(C(C(OCC)=O)(COC(CC1=CC(C(N(C)C)=O)=C(C=C1)NC(C2=CC=CC=C2C3=CC=C(C=C3)C(F)(F)F)=O)=O)C4=CC=CC=C4)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/granotapide.html |