T-Cadinol | MedChemExpress (MCE)
T-Cadinol is a sesquiterpene isolated from C. sylvestris that exhibits anti-Trypanosoma cruzi activity, with IC50 values of 18.2 μM and 15.8 μM against trypomastigote and amastigote forms, respectively. T-Cadinol can induce mitochondrial damage in parasites, leading to membrane hyperpolarization and decreased levels of reactive oxygen species. T-Cadinol can be used for the research of Chagas disease[1].
| Trivial name | T-Cadinol |
| Catalog Number | HY-N12788 |
| Research Area | Infection |
| CAS# | 5937-11-1 |
| Purity | ≥98.0% |
| SMILES | CC([C@H]1[C@@]2([H])[C@](CCC(C)=C2)([H])[C@@](O)(CC1)C)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/t-cadinol.html |