Aciclovir (Acyclovir) 10mM * 1mL in DMSO
Aciclovir is an antiviral agent primarily used for the treatment of herpes simplex virus infections, as well as in the treatment of varicella zoster (chickenpox) and herpes zoster (shingles). It was seen as the start of a new era in antiviral therapy, as it is extremely selective and low in cytotoxicity.
| Trivial name | Aciclovir (Acyclovir) 10mM * 1mL in DMSO |
| Catalog Number | A10037-10mM-D |
| Alternative Name(s) | 2-Amino-1,9-dihydro-9-((2-hydroxyethoxy)methyl)-6H-purin-6-one |
| Molecular Formula | C8H11N5O3 |
| CAS# | 59277-89-3 |
| SMILES | C1=NC2=C(N1COCCO)NC(=NC2=O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/aciclovir-acyclovir.html |
