trans-Permethrinic Acid
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-T-39120 |
| Alternative Name(s) | (1R,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid |
| Research Area | trans-Permethrinic acid acid is a potent insecticide used in the agricultural industry to eliminate unwanted pests from crops. trans-Permethrinic acid is also metabolite of pyrethroid compounds, a group of pesticides that are relatively low toxicity (to organisms that are not intended to be targeted) and biodegradable. |
| Molecular Formula | C8H10Cl2O2 |
| CAS# | 59042-50-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1([C@H]([C@@H]1C(O)=O)/C=C(Cl)/Cl)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST39120.html |
| Additional Information | NULL |