Betaine HCl
Betaine HCl is an acidic form of betaine and a vitamin-like substance found in grains and other foods. It improves the amplification of DNA by reducing the formation of secondary structure in GC-rich regions.
| Trivial name | Betaine Chloride |
| Catalog Number | CSN16769 |
| Alternative Name(s) | Betaine Chloride |
| Research Area | / |
| Molecular Formula | C5H12ClNO2 |
| CAS# | 590-46-5 |
| Purity | ≥99% |
| SMILES | O=C([O-])C[N+](C)(C)C.[H]Cl |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/betaine-hcl.html |
