Levodopa
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01774 |
| Alternative Name(s) | L-DOPA;2-amino-3-(3,4-dihydroxyphenyl)propanoc cid |
| Research Area | The naturally occurring form of DIHYDROXYPHENYLALANINE and the immediate precursor of DOPAMINEIt is used for the treatment of PARKINSONIAN DISORDERS. |
| Molecular Formula | C9H11NO4 |
| CAS# | 59-92-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H](C(O)=O)CC1=CC(O)=C(O)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01774.html |
| Additional Information | NULL |