Acetazolamide
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-07116 |
| Alternative Name(s) | 5-cetamido-1,3,4-thiadiazole-2-sulfonamide; cetamox; Atenezol |
| Research Area | Acetazolamide is a sulfonamide derivative with diuretic, antiglaucoma, and anticonvulsant properties. Acetazolamide is a non-competitive inhibitor of carbonic anhydrase, an enzyme found in cells in the proximal tube of the kidney, the eye, and glial cells |
| Molecular Formula | C4H6N4O3S2 |
| CAS# | 59-66-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[S](=O)(C1=NN=C(NC(C)=O)S1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07116.html |
| Additional Information | NULL |