Acetazolamide
carbonic anhydrase (CA) inhibitor Metabolism|Carbonic Anhydrase
| Catalog Number | B6125-50 |
| Research Area | Metabolism|Carbonic Anhydrase |
| Molecular Formula | C4H6N4O3S2 |
| CAS# | 59-66-5 |
| Purity | 99.11% |
| SMILES | C/C(O)=N/C1=NN=C(S(N)(=O)=O)S1 |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6125 |
