Folic Acid
Folic acid, a B vitamin, plays an important role in cell division and in the synthesis of amino acids and nucleic acids like DNA.
| Trivial name | Folacin; Vitamin B9; Vitamin M |
| Catalog Number | CSN10050 |
| Alternative Name(s) | Folacin; Vitamin B9; Vitamin M |
| Research Area | Metabolic Disease |
| Molecular Formula | C19H19N7O6 |
| CAS# | 59-30-3 |
| Purity | ≥98% |
| SMILES | O=C(O)CC[C@@H](C(O)=O)NC(C1=CC=C(NCC2=NC3=C(N=C2)N=C(N)NC3=O)C=C1)=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/folic-acid.html |
