D-Galactose
D-Galactose is an aldohexose that occurs naturally in the D-form that can be converted enzymatically into D-glucose for metabolism or polysaccharides for storage. It accelerates senescence in invertebrates and mammals and has been used as a model for aging.
| Trivial name | D-Galactopyranose; D-(+)-Galactose |
| Catalog Number | CSN20792 |
| Alternative Name(s) | D-Galactopyranose; D-(+)-Galactose |
| Research Area | / |
| Molecular Formula | C6H12O6 |
| CAS# | 59-23-4 |
| Purity | ≥98% |
| SMILES | O=C[C@@H]([C@H]([C@H]([C@@H](CO)O)O)O)O |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/d-galactose.html |