Cyclizine 2HCl
Histamine H1 receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1548-50 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C18H22N2.2HCl |
| CAS# | 5897-18-7 |
| Purity | 98% |
| SMILES | CN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl.Cl |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1548 |
