Trichostatin A
Trichostatin A is a selective and potent HDAC inhibitor with IC50 of ~1.8 nM and HDAC8 is the only known member of the HDAC-family that is not affected by TSA.
| Trivial name | TSA |
| Catalog Number | CSN12139 |
| Alternative Name(s) | TSA |
| Research Area | Cancer|Infection |
| Molecular Formula | C17H22N2O3 |
| CAS# | 58880-19-6 |
| Purity | ≥99% |
| SMILES | CN(C1=CC=C(C=C1)C([C@@H](/C=C(/C=C/C(NO)=O)C)C)=O)C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/trichostatin-a.html |
