KU-55933
KU-55933 is a potent and specific ATM inhibitor with IC50/Ki of 12.9 nM/2.2 nM in cell-free assays, and is highly selective for ATM as compared to DNA-PK, PI3K/PI4K, ATR and mTOR. KU‑55933 (ATM Kinase Inhibitor) inhibits the activation of autophagy‑initiating kinase ULK1 and results in a significant decrease of autophagy.
| Trivial name | ATM Kinase Inhibitor |
| Catalog Number | S1092 |
| Molecular Formula | C6H5NO3 |
| CAS# | 587871-26-9 |
| Inchi | InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) |
| Inchi Key | BLHCMGRVFXRYRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC=C1C(=O)O |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/KU-55933.html |
| Additional Information | https://file.selleck.cn/downloads/struct/KU-55933-chemical-structure-S1092.gif |
