KU-55933 10mM * 1mL in DMSO
KU-55933 is an ATM inhibitor by suppressing cell proliferation and induces apoptosis by blocking Akt in cancer cells with overactivated Akt.
| Trivial name | KU-55933 10mM * 1mL in DMSO |
| Catalog Number | A10506-10mM-D |
| Alternative Name(s) | 2-(4-Morpholinyl)-6-(1-thianthrenyl)-4H-pyran-4-one |
| Molecular Formula | C21H17NO3S2 |
| CAS# | 587871-26-9 |
| SMILES | C1COCCN1C2=CC(=O)C=C(O2)C3=C4C(=CC=C3)SC5=CC=CC=C5S4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ku-55933.html |