C7280948
Novel PRMT1 inhibitor Chromatin/Epigenetics|Histone Methyltransferase
 
                    | Catalog Number | B5913-10 | 
| Research Area | Chromatin/Epigenetics|Histone Methyltransferase | 
| Molecular Formula | C14H16N2O2S | 
| CAS# | 587850-67-7 | 
| Purity | 98% | 
| SMILES | NC1=CC=C(S(NCCC2=CC=CC=C2)(=O)=O)C=C1 | 
| Size | 10mg | 
| Supplier Page | https://www.apexbt.com/search.php?catalog=B5913 | 
 
                    