ZCL-278 10mM * 1mL in DMSO
ZCL-278 is a selective inhibitor of Cdc42. Targets the binding site of the Cdc42 guanine nucleotide exchange factor, intersectin (ITSN). Inhibits Cdc42-mediated cellular effects, including microspike formation in 3T3 fibroblasts and neuronal branching in primary neonatal cortical neurons. Also suppresses cell motility and migration in PC3 cells, without cytotoxic effects.
| Trivial name | ZCL-278 10mM * 1mL in DMSO |
| Catalog Number | A13403-10mM-D |
| Alternative Name(s) | 2-(4-Bromo-2-chlorophenoxy)-N-[[[4-?[[(4,6-dimethyl-2-pyrimidinyl)amino]sulfonyl]pheny?l]amino]thioxomethyl]acetamide |
| Molecular Formula | C21H19BrClN5O4S2 |
| CAS# | 587841-73-4 |
| SMILES | CC1=CC(=NC(=N1)NS(=O)(=O)C2=CC=C(C=C2)NC(=S)NC(=O)COC3=C(C=C(C=C3)Br)Cl)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/zcl-278.html |
