γ-Glu-Ala
γ-Glu-Ala is a dipeptide composed of gamma-glutamate and alanine and is a proteolytic breakdown product of larger proteins. It belongs to the family of N-acyl-alpha amino acids and derivatives, which formed an amide bond with the nitrogen of L-alanine at the γ carboxylic acid moiety of glutamate. γ-Glu-Ala is the natural substrate of CRF21 (γ-Glutamylcyclotransferase, GGCT).
| Catalog Number | 10-101-278 |
| Alternative Name(s) | gamma-L-Glutamyl-L-alanine |
| Molecular Formula | C8H14N2O5 |
| CAS# | 5875-41-2 |
| Purity | >98% |
| Inchi | InChI=1S/C8H14N2O5/c1-4(7(12)13)10-6(11)3-2-5(9)8(14)15/h4-5H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1 |
| Inchi Key | WQXXXVRAFAKQJM-WHFBIAKZSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/glu-ala-item-10-101-278-39374.html |