3-O-Methyldopa d3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02682 |
| Alternative Name(s) | (2S)‐2‐amino‐3‐[4‐hydroxy‐3‐ (D3)methoxyphenyl]propanoc cid;CS-O-14378 |
| Research Area | Labeled Methyldopa, intended for use as an internal standard for the quantification of Methyldopa by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H10NO4D3 |
| CAS# | 586954-09-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H](C(O)=O)CC1=CC(OC([2H])([2H])[2H])=C(O)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02682.html |
| Additional Information | NULL |