Losmapimod 10mM * 1mL in DMSO
Losmapimod, also know as GW856553 or GW856553X, is a drug developed by GlaxoSmithKline which acts as a selective inhibitor of the enzyme family known as p38 mitogen-activated protein kinases.
| Trivial name | Losmapimod 10mM * 1mL in DMSO |
| Catalog Number | A12526-10mM-D |
| Alternative Name(s) | 6-[5-(Cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)pyridine-3-carboxamide |
| Molecular Formula | C22H26FN3O2 |
| CAS# | 585543-15-3 |
| SMILES | CC1=C(C=C(C=C1C2=NC=C(C=C2)C(=O)NCC(C)(C)C)C(=O)NC3CC3)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/losmapimod.html |