Carboprost tromethamine
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-01214 |
| Alternative Name(s) | Free Salt: 35700-23-3;2-Amino-2-(hydroxymethyl)-1,3-propanediol (5Z,9α,11α,13E,15S)-9,11,15-Trihydroxy-15-methylprosta-5,13-dien-1-oate (Salt)prost Tromethaminthamine Salt; Hemabate; Prostin 15M; Prostinfenem; |
| Research Area | Carboprost Tromethanimine is the salt of Carboprost, an analog of prostaglandin F2α. |
| Molecular Formula | C25H47NO8 |
| CAS# | 58551-69-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(CO)(CO)CO.O[C@@H]1[C@@H]([C@H]([C@H](O)C1)/C=C/[C@@](C)(O)CCCCC)C/C=CCCCC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01214.html |
| Additional Information | NULL |