Schisantherin A
Schisantherin A is a natural product isolated and purified from the herbs of Chelidonium majus with anti-microbial, anti-oxidant and anti-inflammatory properties, and is a specific inhibitor of Rac1b.
| Trivial name | Gomisin-C; Wuweizi Ester A |
| Catalog Number | CSN16630 |
| Alternative Name(s) | Gomisin-C; Wuweizi Ester A |
| Research Area | Neurological Disease |
| Molecular Formula | C30H32O9 |
| CAS# | 58546-56-8 |
| Purity | ≥98% |
| SMILES | O[C@]([C@@H](C)C1)(C)[C@@H](OC(C2=CC=CC=C2)=O)C3=CC(OC)=C(OC)C(OC)=C3C4=C1C=C5OCOC5=C4OC |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/schisantherin-a.html |