α,β-Trehalose | MedChemExpress (MCE)
α,β-Trehalose is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | α,β-Trehalose |
| Catalog Number | HY-W145656 |
| Alternative Name(s) | alpha,beta-Trehalose |
| Research Area | Others |
| CAS# | 585-91-1 |
| Purity | ≥99.00% |
| SMILES | OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO |
| PubChem Chemical Structure ID | 10871590 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-β-trehalose.html |