Undulatoside A
Undulatoside A, a natural product isolated and purified from the herbs of Knoxia corymbosa with anti-inflammatory activity, exhibits inhibition on nitric oxide production in lipopolysaccharide induced RAW 264.7 macrophages with the IC50 value of 49.8 uM.
| Trivial name | Undulatoside-A |
| Catalog Number | CSN14682 |
| Alternative Name(s) | Undulatoside-A |
| Research Area | / |
| Molecular Formula | C16H18O9 |
| CAS# | 58108-99-9 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C)OC2=CC(O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)=CC(O)=C12 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/undulatoside-a.html |