Zuclopenthixol dihydrochloride | MedChemExpress (MCE)
Zuclopenthixol ((Z)-Clopenthixol) dihydrochloride is a thioxanthene derivative which acts as a mixed dopamine D1/D2 receptor antagonist. Zuclopenthixol dihydrochloride is used in the study of schizophrenia[1][2][3].
| Trivial name | Zuclopenthixol dihydrochloride |
| Catalog Number | HY-A0163B |
| Alternative Name(s) | (Z)-Clopenthixol dihydrochloride |
| Research Area | Neurological Disease |
| CAS# | 58045-23-1 |
| Purity | 99.98% |
| SMILES | ClC1=CC2=C(C=C1)SC3=C(C=CC=C3)/C2=C/CCN4CCN(CC4)CCO.[H]Cl.[H]Cl |
| PubChem Chemical Structure ID | 6433208 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/zuclopenthixol-dihydrochloride.html |