Uridine
DNA/RNA synthesis chemical DNA Damage/DNA Repair|DNA Synthesis
| Catalog Number | B1473-50 |
| Research Area | DNA Damage/DNA Repair|DNA Synthesis |
| Molecular Formula | C9H12N2O6 |
| CAS# | 58-96-8 |
| Purity | 99.95% |
| SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1473 |
