D-α-Tocopherol Acetate
Phytochemicals
| Trivial name | NULL |
| Catalog Number | CS-O-01399 |
| Alternative Name(s) | Vitamine E Acetate;(2R)-3,4-Dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltrte; Ephyna5;-Tcopherol cetate; (+)-α-Tcopheryl cetate; (2R,4R,8R)-α-Tcopherol cetate |
| Research Area | α-Tocopherol acetate is the most bioactive of the naturally occurring forms of Vitamin E. Richest sources are green vegetables, grains, and oils, particularly palm, safflower and sunflower oils. |
| Molecular Formula | C31H52O3 |
| CAS# | 58-95-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CC2)C2=C(C)C(OC(C)=O)=C1C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01399.html |
| Additional Information | NULL |